| Identification | |
| Name: | 4-Pentenoic acid,2-propyl- |
| CAS: | 1575-72-0 |
| Molecular Formula: | C8H14 O2 |
| Molecular Weight: | 142.22 |
| InChI: | InChI=1/C8H14O2/c1-3-5-7(6-4-2)8(9)10/h3,7H,1,4-6H2,2H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 126.2°C |
| Boiling Point: | 228.8°Cat760mmHg |
| Density: | 0.943g/cm3 |
| Refractive index: | 1.448 |
| Specification: |
2-Allylpentanoic acid , its CAS NO. is 1575-72-0, the synonyms are (+-)-2-n-Propyl-4-pentenoic acid ; (+-)-4-En-valproic acid ; 0-02-00-00452 (Beilstein Handbook Reference) ; 2-Allylvaleric acid ; 2-Propyl-4-pentenoic acid ; BRN 1704069 ; Pentanoic acid, 2-(2-propenyl)- ; R,S-4-en-VPA ; 4-Pentenoic acid, 2-propyl- . |
| Flash Point: | 126.2°C |
| Storage Temperature: | Refrigerator |
| Usage: | A metabolite of Valproic Acid |
| Safety Data | |
| Hazard Symbols | |
 |
|
