| Identification |
| Name: | Benzaldehyde,2,4-dimethyl- |
| Synonyms: | 2,4-Dimethylbenzaldehyde;2,4-Dimethylbenzenecarboxaldehyde |
| CAS: | 15764-16-6 |
| EINECS: | 239-856-7 |
| Molecular Formula: | C9H10 O |
| Molecular Weight: | 134.18 |
| InChI: | InChI=1/C9H10O/c1-7-3-4-9(6-10)8(2)5-7/h3-6H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.962 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5482-1.5502 |
| Water Solubility: | insoluble in water; soluble in organic solvents, oils |
| Solubility: | insoluble in water; soluble in organic solvents, oils |
| Appearance: | colourless liquid with a mild, sweet, bitter-almond odour |
| HS Code: | 29122900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| |
 |
