| Identification | |
| Name: | 2,3-Quinoxalinedione,1,4-dihydro- |
| Synonyms: | 1,2,3,4-Tetrahydro-2,3-dioxoquinoxaline;1,4-Dihydro-2,3-quinoxalinedione;2,3(1H,4H)-Quinoxalinedione;2,3-Dihydroxyquinoxaline;2,3-Quinoxalinediol;NSC 8698;NSC 9431; |
| CAS: | 15804-19-0 |
| EINECS: | 239-901-0 |
| Molecular Formula: | C8H6 N2 O2 |
| Molecular Weight: | 162.14 |
| InChI: | InChI=1/C8H6N2O2/c11-7-8(12)10-6-4-2-1-3-5(6)9-7/h1-4H,(H,9,11)(H,10,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 238.6°C |
| Boiling Point: | 470.9°Cat760mmHg |
| Density: | 1.336g/cm3 |
| Refractive index: | 1.762 |
| Specification: |
2,3-Quinoxalinediol (15804-19-0) is an off-white powder which is stable under normal temperatures and pressures. It should store in a cool, dry place with a tightly closed container. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 238.6°C |
| Safety Data | |
 |
|
