| Identification | |
| Name: | Benzeneethanamine,4-fluoro- |
| Synonyms: | Phenethylamine,p-fluoro- (8CI);(p-Fluorophenyl)ethylamine;2-(4-Fluorophenyl)ethanamine;2-(4-Fluorophenyl)ethylamine;2-(p-Fluorophenyl)ethylamine;4-(2-Aminoethyl)fluorobenzene;4-Fluorobenzeneethanamine;p-Fluorophenethylamine; |
| CAS: | 1583-88-6 |
| EINECS: | 216-435-6 |
| Molecular Formula: | C8H10FN |
| Molecular Weight: | 139.17 |
| InChI: | InChI=1/C8H10FN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5-6,10H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2922 |
| Density: | 1.061 |
| Refractive index: | 1.506-1.508 |
| Appearance: | clear colorless to slightly yellow liquid |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Safety Data | |
| Hazard Symbols |
T:Toxic
C:Corrosive
|
 |
|
