Identification |
Name: | thallium acetate |
Synonyms: | 239-947-1;acetic acid, thallium(1+) salt (1:1);Thallium acetate (VAN);Thallium(1+) acetate;acetate, thallium salt |
CAS: | 15843-14-8 |
EINECS: | 239-947-1 |
Molecular Formula: | C2H3O2Tl |
Molecular Weight: | 263.4279 |
InChI: | InChI=1/C2H4O2.Tl/c1-2(3)4;/h1H3,(H,3,4);/p-1 |
Molecular Structure: |
 |
Properties |
Melting Point: | 131 DEG C |
Flash Point: | 40°C |
Boiling Point: | 117.1°C at 760 mmHg |
Solubility: | SOL IN ALCOHOL AND WATER VERY SOL IN CHLOROFORM Soluble in water and ethanol Insol in acetone |
Flash Point: | 40°C |
Color: | WHITE CRYSTALS |
Safety Data |
|
 |