| Identification | |
| Name: | thallium acetate |
| Synonyms: | 239-947-1;acetic acid, thallium(1+) salt (1:1);Thallium acetate (VAN);Thallium(1+) acetate;acetate, thallium salt |
| CAS: | 15843-14-8 |
| EINECS: | 239-947-1 |
| Molecular Formula: | C2H3O2Tl |
| Molecular Weight: | 263.4279 |
| InChI: | InChI=1/C2H4O2.Tl/c1-2(3)4;/h1H3,(H,3,4);/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 131 DEG C |
| Flash Point: | 40°C |
| Boiling Point: | 117.1°C at 760 mmHg |
| Solubility: | SOL IN ALCOHOL AND WATER VERY SOL IN CHLOROFORM Soluble in water and ethanol Insol in acetone |
| Flash Point: | 40°C |
| Color: | WHITE CRYSTALS |
| Safety Data | |
 |
|
