| Identification | |
| Name: | p-Bromoethylbenzene |
| Synonyms: | 1-Bromo-4-ethylbenzene; 1-Bromo-4-ehtylbenzene; 4-Ethylbromobenzene; 4-Bromoethylbenzene |
| CAS: | 1585-07-5 |
| EINECS: | 216-439-8 |
| Molecular Formula: | C8H9Br |
| Molecular Weight: | 185.06 |
| InChI: | InChI=1/C8H9Br/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.342 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.5435-1.5455 |
| Water Solubility: | 23.3 mg/L at 25 °C in water |
| Appearance: | Clear colourless to light yellow liquid |
| Specification: |
? p-Bromoethylbenzene (CAS NO.1585-07-5), its Synonyms are 1-Bromo-4-ethylbenzene ; 4-Ethylbromobenzene ; p-Ethylbromobenzene ; Benzene, 1-bromo-4-ethyl- . |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
