| Identification | |
| Name: | Trityl hexachloroantimonate |
| Synonyms: | Trityl antimony hexachloride;Methylium, triphenyl-, (OC-6-11)-hexachloroantimonate(1-);Triphenylcarbonium hexachloroantimonate;Tritylium, hexachloroantimonate (1-);Trityl hexachloroantimonate (1-);Tritylium hexachloroantimonate (V);Triphenylcarbenium hexachloroantimonate;Triphenylmethylium hexachloroantimonate; |
| CAS: | 1586-91-0 |
| EINECS: | 216-446-6 |
| Molecular Formula: | C19 H15Cl6Sb |
| Molecular Weight: | 577.79 |
| InChI: | InChI=1/C19H15.6ClH.Sb/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;;/h1-15H;6*1H;/q+1;;;;;;;-5/p-6/rC19H15.Cl6Sb/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-11 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 |
| Appearance: | yellow powder |
| Specification: | YELLOW POWDER Safety Statements:61 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
