Identification |
Name: | Trityl hexachloroantimonate |
Synonyms: | Trityl antimony hexachloride;Methylium, triphenyl-, (OC-6-11)-hexachloroantimonate(1-);Triphenylcarbonium hexachloroantimonate;Tritylium, hexachloroantimonate (1-);Trityl hexachloroantimonate (1-);Tritylium hexachloroantimonate (V);Triphenylcarbenium hexachloroantimonate;Triphenylmethylium hexachloroantimonate; |
CAS: | 1586-91-0 |
EINECS: | 216-446-6 |
Molecular Formula: | C19 H15Cl6Sb |
Molecular Weight: | 577.79 |
InChI: | InChI=1/C19H15.6ClH.Sb/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;;/h1-15H;6*1H;/q+1;;;;;;;-5/p-6/rC19H15.Cl6Sb/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-11 |
Molecular Structure: |
 |
Properties |
Transport: | UN3077 |
Appearance: | yellow powder |
Specification: | YELLOW POWDER Safety Statements:61 61:Avoid release to the environment. Refer to special instructions
safety data sheet |
Packinggroup: | III |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
|
 |