| Identification | |
| Name: | 2-Piperidinecarboxylicacid, ethyl ester |
| Synonyms: | Pipecolicacid, ethyl ester (6CI,7CI,8CI);Pipecolinic acid ethyl ester;2-(Ethoxycarbonyl)piperidine;DL-Ethyl pipecolinate;DL-Pipecolic acid ethyl ester;Ethyl 2-pipecolate;NSC 49360; |
| CAS: | 15862-72-3 |
| EINECS: | 239-990-6 |
| Molecular Formula: | C8H15NO2 |
| Molecular Weight: | 157.21 |
| InChI: | InChI=1/C8H15NO2/c1-2-11-8(10)7-5-3-4-6-9-7/h7,9H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.006 |
| Refractive index: | 1.4562 |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | Colorless or yellowish liquid |
| Specification: |
Ethyl piperidine-2-carboxylate , its cas register number is 15862-72-3. It also can be called Ethyl pipecolinate ; Pipecolinic acid ethyl ester ; Ethyl 2-piperidinecarboxylate .It is a clear colorless to light yellow liquid. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
