| Identification | |
| Name: | Pentanamide,5-chloro-N-cyclohexyl- |
| Synonyms: | Valeramide,5-chloro-N-cyclohexyl- (8CI);5-Chloro-N-cyclohexylpentanamide;5-Chloro-N-cyclohexylvaleramide;N-Cyclohexyl-5-chloropentanamide; |
| CAS: | 15865-18-6 |
| Molecular Formula: | C11H20ClNO |
| Molecular Weight: | 217.74 |
| InChI: | InChI=1/C11H20ClNO/c12-9-5-4-8-11(14)13-10-6-2-1-3-7-10/h10H,1-9H2,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.043 g/cm3 |
| Refractive index: | 1.482 |
| Specification: |
The systematic name of N-Cyclohexyl-5-chlorovaleramide is 5-Chloro-N-cyclohexylpentanamide . With CAS registry number 15865-18-6, it is also named as 5-Chloro-N-cyclohexylpentanamide ; N-Cyclohexyl-5-chloropentanamide ; Pentanamide, 5-chloro-N-cyclohexyl- . People can use the following data to know the molecule structure. SMILES: O=C(NC1CCCCC1)CCCCCl; InChI: InChI=1/C11H20ClNO/c12-9-5-4-8-11(14)13-10-6-2-1-3-7-10/h10H,1-9H2,(H,13,14); InChIKey: OBOBOCFRZMDIDG-UHFFFAOYAA; Std. InChI: InChI=1S/C11H20ClNO/c12-9-5-4-8-11(14)13-10-6-2-1-3-7-10/h10H,1-9H2,(H,13,14); Std. InChIKey:OBOBOCFRZMDIDG-UHFFFAOYSA-N . |
| Safety Data | |
 |
|
