Identification |
Name: | 2-Piperidinecarboxamide,N-(2,6-dimethylphenyl)- |
Synonyms: | N-(2',6'-dimethylphenl)-2-Piperidine;2',6'-Pipecoloxylidide(6CI,7CI,8CI);Debutylbupivacaine;Desbutylbupivacaine;N-Desbutylbupivacaine; |
CAS: | 15883-20-2 |
Molecular Formula: | C14H20N2O |
Molecular Weight: | 232.32 |
InChI: | InChI=1/C14H20N2O/c1-10-6-5-7-11(2)13(10)16-14(17)12-8-3-4-9-15-12/h5-7,12,15H,3-4,8-9H2,1-2H3,(H,16,17) |
Molecular Structure: |
 |
Properties |
Melting Point: | 114-117 ºC |
Flash Point: | 149 ºC |
Boiling Point: | 392.3 ºC at 760 mmHg |
Density: | 1.087 g/cm3 |
Refractive index: | 1.567 |
Appearance: | Off-white to light yellow powder |
Flash Point: | 149 ºC |
Usage: | A major metabolite of Bupivacaine |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |