| Identification |
| Name: | Frovatriptan succinate [USAN] |
| Synonyms: | Frovatriptan succinate;Butanedioic acid, compd. with (R)-2,3,4,9-tetrahydro-3-(methylamino)-1H-carbazole-6-carboxamide (1:1), monohydrate;1H-Carbazole-6-carboxamide, 2,3,4,9-tetrahydro-3-(methylamino)-, (R)-, butanedioate (1:1), monohydrate;butanedioic acid; (6R)-6-methylamino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide; hydrate;Frovatriptan succinate hydrate; |
| CAS: | 158930-17-7 |
| Molecular Formula: | C18H25N3O6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H17N3O.C4H6O4.H2O/c1-16-9-3-5-13-11(7-9)10-6-8(14(15)18)2-4-12(10)17-13;5-3(6)1-2-4(7)8;/h2,4,6,9,16-17H,3,5,7H2,1H3,(H2,15,18);1-2H2,(H,5,6)(H,7,8);1H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 265.4°C |
| Boiling Point: | 515.2°Cat760mmHg |
| Density: | 1.27g/cm3 |
| Flash Point: | 265.4°C |
| Usage: | Serotonin 5-HT1B/1D receptor agonist. It is a triptan drug for the treatment of migraine headaches. Frovatriptan causes vasoconstriction of arteries and veins that supply blood to the head |
| Safety Data |
| |
 |
