| Identification | |
| Name: | 4,4'-Biphenyldicarbonitrile |
| Synonyms: | 4,4-Dicyanobiphenyl |
| CAS: | 1591-30-6 |
| EINECS: | 216-468-6 |
| Molecular Formula: | C14H8N2 |
| Molecular Weight: | 204.23 |
| InChI: | InChI=1/C14H8N2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Flash Point: | 199.2°C |
| Boiling Point: | 403.5°C at 760 mmHg |
| Density: | 1.2g/cm3 |
| Refractive index: | 1.631 |
| Specification: | Safety Statements:36/37 36/37:Wear suitable protective clothing and gloves |
| Report: |
Reported in EPA TSCA Inventory. Cyanide and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | III |
| Flash Point: | 199.2°C |
| Safety Data | |
 |
|
