| Identification | |
| Name: | Benzene,4-bromo-1-isocyanato-2-methyl- |
| Synonyms: | Isocyanicacid, 4-bromo-o-tolyl ester (7CI);4-Bromo-2-methylphenyl isocyanate; |
| CAS: | 1591-98-6 |
| Molecular Formula: | C8H6BrNO |
| Molecular Weight: | 212.04 |
| InChI: | InChI=1/C8H6BrNO/c1-6-4-7(9)2-3-8(6)10-5-11/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 107.9 ºC |
| Boiling Point: | 254.7 ºCat 760 mmHg |
| Density: | 1.44 g/cm3 |
| Refractive index: | 1.571 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Flash Point: | 107.9 ºC |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
