| Identification | |
| Name: | Benzene,1-(chloromethyl)-4-ethenyl- |
| Synonyms: | Styrene,p-(chloromethyl)- (6CI,7CI,8CI);1-(Chloromethyl)-4-vinylbenzene;4-(Chloromethyl)styrene;CMS 14;p-(Chloromethyl)styrene;p-Vinylbenzyl chloride; |
| CAS: | 1592-20-7 |
| EINECS: | 216-471-2 |
| Molecular Formula: | C9H9Cl |
| Molecular Weight: | 152.62 |
| InChI: | InChI=1/C9H9Cl/c1-2-8-3-5-9(7-10)6-4-8/h2-6H,1,7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.083 |
| Stability: | Stable under normal temperatures and pressures. Air sensitive Light sensitive. |
| Refractive index: | 1.5731-1.5751 |
| Solubility: | Insoluble |
| Appearance: | Clear yellow liquid. |
| Specification: | clear yellow liquid Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Storage Temperature: | −20°C |
| Usage: | Synthesis of anion exchange resins. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
