| Identification |
| Name: | Azepino[4,5-b]indole,1,2,3,4,5,6-hexahydro-6-methyl- |
| Synonyms: | PNU 22394;U 22394A |
| CAS: | 15923-78-1 |
| Molecular Formula: | C13H16 N2 |
| Molecular Weight: | 236.74 |
| InChI: | InChI=1/C13H16N2.ClH/c1-15-12-5-3-2-4-10(12)11-6-8-14-9-7-13(11)15;/h2-5,14H,6-9H2,1H3;1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 201.6°C |
| Boiling Point: | 409.7°Cat760mmHg |
| Density: | g/cm3 |
| Biological Activity: | Potent 5-HT 2C agonist and partial 5-HT 2A /5-HT 2B agonist. Non-selective between 5-HT 2 receptor subtypes (K i values are 18, 18 and 66 nM for human recombinant 5-HT 2C , 5-HT 2A and 5-HT 2B receptors respectively). Reduces food intake in rats following subcutaneous administration and displays anorexigenic effects in humans. |
| Flash Point: | 201.6°C |
| Safety Data |
| |
 |
