| Identification | |
| Name: | 2-Quinoxalinecarboxaldehyde |
| Synonyms: | 2-Formylquinoxaline;Quinoxalin-2-carboxaldehyde |
| CAS: | 1593-08-4 |
| Molecular Formula: | C9H6 N2 O |
| Molecular Weight: | 158.16 |
| InChI: | InChI=1/C9H6N2O/c12-6-7-5-10-8-3-1-2-4-9(8)11-7/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 107-111°C |
| Flash Point: | 151.6°C |
| Boiling Point: | 319.8°Cat760mmHg |
| Density: | 1.299g/cm3 |
| Refractive index: | 1.7 |
| Specification: | usageEng:A 2-substituted quinoxaline derivative used in the the preparation of stabilized hemiacetals with a wide range of cosmetic uses. Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 151.6°C |
| Usage: | A 2-substituted quinoxaline derivative used in the the preparation of stabilized hemiacetals with a wide range of cosmetic uses. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
