Identification |
Name: | 2,5-Pyrrolidinedione,1-[4-[4-(2-methoxyphenyl)-1-piperazinyl]butyl]- |
Synonyms: | MM 77 |
CAS: | 159311-94-1 |
Molecular Formula: | C19H27 N3 O3 |
Molecular Weight: | 418.36 |
InChI: | InChI=1/C19H27N3O3.2ClH/c1-25-17-7-3-2-6-16(17)21-14-12-20(13-15-21)10-4-5-11-22-18(23)8-9-19(22)24;;/h2-3,6-7H,4-5,8-15H2,1H3;2*1H |
Molecular Structure: |
|
Properties |
Flash Point: | 311.1°C |
Boiling Point: | 590.7°Cat760mmHg |
Density: | g/cm3 |
Biological Activity: | A highly potent and fairly selective 5-HT 1A ligand, which may be a full antagonist at postsynaptic receptors. |
Flash Point: | 311.1°C |
Safety Data |
|
|