| Identification | |
| Name: | Cyclohexanone,5-methyl-2-(1-methylethylidene)- |
| CAS: | 15932-80-6 |
| EINECS: | 240-070-1 |
| Molecular Formula: | C10H16 O |
| Molecular Weight: | 152.26 |
| InChI: | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8H,4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 92.5°C |
| Boiling Point: | 224°Cat760mmHg |
| Density: | 0.923g/cm3 |
| Refractive index: | 1.469 |
| Specification: |
P-Menth-4(8)-En-3-One (CAS NO.15932-80-6) is a clear colorless oily liquid and has a pleasant odor similar to pennyroyal, peppermint and camphor. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 92.5°C |
| Safety Data | |
 |
|
