| Identification | |
| Name: | Thiocyanic acid,2,4-dinitrophenyl ester |
| Synonyms: | Benzene,2,4-dinitro-1-thiocyanato- (6CI);2,4-Dinitro-1-thiocyanobenzene;2,4-Dinitrophenyl thiocyanate;2,4-Dinitrothiocyanatobenzene;2317W;DNRB;DNTB;Grzybol;NBT;NBT (pesticide);NSC 540;Nirit;Nirit Supra;RDNB;Rhodandinitrobenzol;Rodatox 60; |
| CAS: | 1594-56-5 |
| EINECS: | 216-477-5 |
| Molecular Formula: | C7H3N3O4S |
| Molecular Weight: | 225.17 |
| InChI: | InChI=1/C7H3N3O4S/c8-4-15-7-2-1-5(9(11)12)3-6(7)10(13)14/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 61655? |
| Density: | 1.62g/cm3 |
| Refractive index: | 1.666 |
| Specification: |
2,4-Dinitrothiocyanatobenzene is known as 2,4-Dinitro-1-thiocyanobenzene ; 2,4-Dinitro-rhodanbenzol ; 2,4-Dinitro-rhodanbenzol [German] ; 2,4-Dinitrofenylthiokyanat ; 2,4-Dinitrofenylthiokyanat [Czech] ; 2,4-Dinitrophenyl thiocyanate ; 2,4-Dinitrothiocyanatebenzene ; 2,4-Dinitrothiocyanobenzene ; 2317-W ; 4-06-00-01760 (Beilstein Handbook Reference) ; AI3-18662 ; CCRIS 3142 ; Caswell No. 392C ; DNRB ; DNTB ; EPA Pesticide Chemical Code 392400 ; Gryzbol ; Grzybol ; NBT (pesticide) ; NSC 540 ; Nirit ; Nirit Supra ; Nitrite ; RDNB ; Rhodandinitrobenzol ; Rodatox 60 ; Tri-Rodazene ; Trirodazeen ; 2,4-Dinitrophenyl thiocyanate ; 2,4-Dinitrophenylthiocyanate ; Thiocyanic acid, 2,4-dinitrophenyl ester with CAS Registry Number of 1594-56-5. |
| Report: |
EPA Genetic Toxicology Program. Community Right-To-Know List. |
| Packinggroup: | III |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
