| Identification |
| Name: | 1-Naphthalenecarboxaldehyde,4-methoxy- |
| Synonyms: | 1-Naphthaldehyde,4-methoxy- (7CI,8CI);4-Methoxy-1-naphthaldehyde;4-Methoxy-1-naphthalenecarboxaldehyde;4-Methoxy-1-naphthylaldehyde;NSC 97025; |
| CAS: | 15971-29-6 |
| EINECS: | 240-109-2 |
| Molecular Formula: | C12H10O2 |
| Molecular Weight: | 186.21 |
| InChI: | InChI=1/C12H10O2/c1-14-12-7-6-9(8-13)10-4-2-3-5-11(10)12/h2-8H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.169 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.6640 |
| Solubility: | Insoluble |
| Appearance: | slightly beige to pink-brown low melting solid / Yellow crystal |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| |
 |
