| Identification | |
| Name: | Alachlor |
| CAS: | 15972-60-8 |
| EINECS: | 240-110-8 |
| Molecular Formula: | C14H20ClNO2 |
| Molecular Weight: | 269.767 |
| InChI: | InChI=1S/C14H20ClNO2/c1-4-11-7-6-8-12(5-2)14(11)16(10-18-3)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3 |
| Molecular Structure: | ![(C14H20ClNO2) Alachlor [ANSI:BSI:ISO];Chimiclor;2-Chloro-N-(2,6-diethyl)phenyl-N-methoxymethylacetamide;Alanox;Chl...](https://img1.guidechem.com/structure/image/15972-60-8.jpg) |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.119 g/cm3 |
| Stability: | Indefinitely stable; not sensitive to light or heat stable to UV radiation. |
| Refractive index: | 1.539 |
| Water Solubility: | 0.024 g/100 mL |
| Solubility: | 0.024 g/100 mL |
| Appearance: | yellowish crystal |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | I; II; III |
| Color: | Colorless to white crystalline solid Cream to wine-red colored solid Colorless to yellow crystals |
| Usage: | Herbicide for grasses & broadleaf weeds on corn & sorghum, soybeans, peanuts, cotton, vegetables, forage crops. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
