| Identification | |
| Name: | 2,3'-anhydrothymidine |
| Synonyms: | - |
| CAS: | 15981-92-7 |
| Molecular Formula: | C10H12N2O4 |
| Molecular Weight: | 224.21 |
| InChI: | InChI=1/C10H12N2O4/c1-5-3-12-8-2-6(7(4-13)15-8)16-10(12)11-9(5)14/h3,6-8,13H,2,4H2,1H3/t6-,7-,8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 246-247oC |
| Flash Point: | 184.7°C |
| Boiling Point: | 381.8°Cat760mmHg |
| Density: | 1.72g/cm3 |
| Refractive index: | 1.735 |
| Appearance: | White Powder |
| Flash Point: | 184.7°C |
| Storage Temperature: | −20°C |
| Usage: | An intermediate in the preparation of thymidine derivatives |
| Safety Data | |
 |
|
