| Identification | |
| Name: | Butanoic acid,2-amino-4-(S-methylsulfonimidoyl)-, (2S)- |
| CAS: | 15985-39-4 |
| EINECS: | 244-566-9 |
| Molecular Formula: | C5H12 N2 O3 S |
| Molecular Weight: | 180.23 |
| InChI: | InChI=1/C5H11NO2S.H3NOS/c1-9-3-2-4(6)5(7)8;1-3-2/h4H,2-3,6H2,1H3,(H,7,8);1H,3H2/t4-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >210 °C (dec.)(lit.) |
| Flash Point: | 166.8°C |
| Boiling Point: | 352.2°Cat760mmHg |
| Density: | 1.46g/cm3 |
| Appearance: | White Crystalline Powder |
| Flash Point: | 166.8°C |
| Storage Temperature: | 0-6°C |
| Usage: | Methionine sulfoximine inhibits both glutamine synthetase and g-glutamylcysteine synthetase. Working concentrations for inhibition of g-glutamylcysteine synthetase are 0.2-2.0 mM (52% inhibition occured at 100 mM). Methionine sulfoximine is also |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
