Identification |
Name: | 2-Piperidinepropanoicacid, a,b-dihydroxy-1-[(phenylmethoxy)carbonyl]-, ethyl ester,[2R-[2R*(aR*,bS*)]]- (9CI) |
Synonyms: | [2R-[2R*(aR*,S*)]]- a,-Dihydroxy-1-[(phenylmethoxy)carbonyl]-2-piperidinepropanoic Acid Ethyl Ester;Ethyl N-Benzyloxycarbonyl-3-[(2R)-piperidinyl)]-(2R,3S)-dihydroxrpropanoate |
CAS: | 160169-48-2 |
Molecular Formula: | C18H25 N O6 |
Molecular Weight: | 0 |
InChI: | InChI=1/C18H25NO6/c1-2-24-17(22)16(21)15(20)14-10-6-7-11-19(14)18(23)25-12-13-8-4-3-5-9-13/h3-5,8-9,14-16,20-21H,2,6-7,10-12H2,1H3/t14-,15-,16+/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 270.85°C |
Boiling Point: | 524.238°C at 760 mmHg |
Density: | 1.256g/cm3 |
Refractive index: | 1.556 |
Flash Point: | 270.85°C |
Usage: | Intermediate for the synthesis of (-)-Lentiginosine |
Safety Data |
|
|