| Identification | |
| Name: | 5-Pyrimidineacetaldehyde,4,6-dichloro- |
| Synonyms: | 2-(4,6-Dichloro-5-pyrimidinyl)acetaldehyde;(4,6-Dichloro-pyrimidin-5-yl)-acetaldehyde;4,6-Dichloro-5-pyrimidineacetaldehyde;5-Acetaldehydeyl-4,6-dichloropyrimidine; |
| CAS: | 16019-33-3 |
| Molecular Formula: | C6H4Cl2N2O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H4Cl2N2O/c7-5-4(1-2-11)6(8)10-3-9-5/h2-3H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.47 g/cm3 |
| Refractive index: | 1.559 |
| Specification: |
The systematic name of 4,6-Dichloro-5-pyrimidineacetaldehyde is 2-(4,6-dichloropyrimidin-5-yl)acetaldehyde. With the CAS registry number 16019-33-3, it is also named as 5-Acetaldehydeyl-4,6-dichloropyrimidine. In addition, its molecular formula is C6H4Cl2N2O and its molecular weight is 191.01. The other characteristics of 4,6-Dichloro-5-pyrimidineacetaldehyde can be summarized as: (1)ACD/LogP: 0.85; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.85; (4)ACD/LogD (pH 7.4): 0.85; (5)H bond acceptors: 3; (6)H bond donors: 0; (7)Freely Rotating Bonds: 2; (8)Polar Surface Area: 42.85 Å2; (9)Index of Refraction: 1.559; (10)Molar Refractivity: 41.96 cm3; (11)Molar Volume: 129.9 cm3; (12)Polarizability: 16.63×10-24cm3; (13)Surface Tension: 54.3 dyne/cm; (14)Density: 1.47 g/cm3; (15)Flash Point: 142.9 °C; (16)Enthalpy of Vaporization: 55.37 kJ/mol; (17)Boiling Point: 312.7 °C at 760 mmHg; (18)Vapour Pressure: 0.00052 mmHg at 25 °C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
