| Identification | |
| Name: | 2-Amino-4-methylthiazole |
| Synonyms: | 4-methylthiazol-2-ylamine; 4-methylthiazol-2-amine |
| CAS: | 1603-91-4 |
| EINECS: | 216-505-6 |
| Molecular Formula: | C4H6N2S |
| Molecular Weight: | 114.16 |
| InChI: | InChI=1/C4H6N2S/c1-3-2-7-4(5)6-3/h2H,1H3,(H2,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.202 g/cm3 (50 C) |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.618 |
| Water Solubility: | soluble |
| Solubility: | soluble AUTOIGNITION |
| Appearance: | White to pale yellow crystals |
| Specification: | white to light yellow crystal powde Safety Statements:26-36-39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 39:Wear eye/face protection |
| HS Code: | 29341000 |
| Storage Temperature: | Refrigerator |
| Sensitive: | Hygroscopic |
| Usage: | Reagent. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
