Identification |
Name: | Creatinine, compd. with zinc chloride |
Synonyms: | CREATININE ZINC CHLORIDE;CREATININE ZINC CHLORIDE SALT;2-AMINO-1-METHYL-2-IMIDAZOLIN-4-ONE ZINC CHLORIDE SALT;ZINC CHLORIDE CREATININE;Creatinine, compd. with zinc chloride;CreatinineZincChloride99%;CREATININE ZINC CHLORIDE 99%;4H-Imidazol-4-one, 2-amino-1,5-dihydro-1-methyl-, compd. with zinc chloride (ZnCl2) |
CAS: | 16045-72-0 |
EINECS: | 240-186-2 |
Molecular Formula: | C8H14Cl2N6O2Zn |
Molecular Weight: | 362.53 |
InChI: | InChI=1/C4H9N3O2.2ClH.Zn/c1-7(4(5)6)2-3(8)9;;;/h2H2,1H3,(H3,5,6)(H,8,9);2*1H;/q;;;+2/p-2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 75.5°C |
Boiling Point: | 201.1°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 75.5°C |
Safety Data |
|
 |