| Identification | |
| Name: | Benzenediazonium,2-methyl-4-nitro- |
| Synonyms: | o-Toluenediazonium,4-nitro- (8CI);2-Methyl-4-nitrobenzenediazonium;Azoic Diazo Component 34;C.I. Azoic Diazo Component 34;Conazoic Diazo CD;DycosbaseRed RL Base;Fast Red RL Salt;Icho Salt Red RL; |
| CAS: | 16047-24-8 |
| EINECS: | 240-190-4 |
| Molecular Formula: | C7H6N3O2 |
| Molecular Weight: | 164.1409 |
| InChI: | InChI=1/C7H6N3O2/c1-5-4-6(10(11)12)2-3-7(5)9-8/h2-4H,1H3/q+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Appearance: | brown crystalline solid |
| Specification: |
The Azoic Diazo Component 34, with the CAS registry number 16047-24-8 and EINECS registry number 240-190-4, has the systematic name of 2-methyl-4-nitrobenzenediazonium. It is a kind of brown crystalline solid, and belongs to the categories of Aromatics Compounds and Aromatics. The molecular formula of the chemical is C7H6N3O2. The characteristics of Azoic Diazo Component 34 are as followings: (1)XLogP3-AA 2.8; (2)H-Bond Donor 0; (3)H-Bond Acceptor 3; (4)Rotatable Bond Count 0; (5)Exact Mass 164.046001; (6)MonoIsotopic Mass 164.046001; (7)Topological Polar Surface Area 74; (8)Heavy Atom Count 12; (9)Formal Charge 1; (10)Complexity 227; (11)Isotope Atom Count 0; (12)Defined Atom StereoCenter Count 0; (13)Undefined Atom StereoCenter Count 0; (14)Defined Bond StereoCenter Count 0; (15)Undefined Bond StereoCenter Count 0; (16)Covalently-Bonded Unit Count 1. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | °C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
