| Identification | |
| Name: | 1,4:3,6-dianhydro-D-glucitol 5-nitrate |
| Synonyms: | Isosorbide mononitrate |
| CAS: | 16051-77-7 |
| EINECS: | 240-197-2 |
| Molecular Formula: | C6H9NO6 |
| Molecular Weight: | 191.14 |
| InChI: | InChI=1/C6H9NO6/c8-3-1-11-6-4(13-7(9)10)2-12-5(3)6/h3-6,8H,1-2H2/t3-,4+,5+,6+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3251 |
| Density: | 1.56g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 170 o (C=1, ETOH) |
| Water Solubility: | soluble |
| Solubility: | Soluble |
| Appearance: | white crystalline powder |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A metabolite of Isosorbide Dinitrate. Used as an antianginal |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
