| Identification |
| Name: | 1H-Indole-3-ethanamine,a-methyl-5-(2-thienylmethoxy)-,hydrochloride (1:1) |
| Synonyms: | 1H-Indole-3-ethanamine,a-methyl-5-(2-thienylmethoxy)-,monohydrochloride (9CI); BW 723C86 |
| CAS: | 160521-72-2 |
| Molecular Formula: | C16H18 N2 O S . Cl H |
| Molecular Weight: | 322.85 |
| InChI: | InChI=1/C16H18N2OS.ClH/c1-11(17)7-12-9-18-16-5-4-13(8-15(12)16)19-10-14-3-2-6-20-14;/h2-6,8-9,11,18H,7,10,17H2,1H3;1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 249.2°C |
| Boiling Point: | 488.4°C at 760 mmHg |
| Biological Activity: | Selective 5-HT 2B receptor agonist. |
| Flash Point: | 249.2°C |
| Color: | white |
| Usage: | A selective 5-HT2B receptor agonist. It is used in the treatment of certain CNS disorders, in particular epilepsy, migraine and feeding disorders |
| Safety Data |
| |
 |
