| Identification | |
| Name: | 1-Pyrenamine |
| Synonyms: | NSC 11436;a-Aminopyrene; |
| CAS: | 1606-67-3 |
| EINECS: | 216-521-3 |
| Molecular Formula: | C16H11N |
| Molecular Weight: | 217.27 |
| InChI: | InChI=1/C16H11N/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H,17H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 246.2°C |
| Boiling Point: | 440.8°Cat760mmHg |
| Density: | 1.322g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.904 |
| Appearance: | yellow-green powder |
| Specification: |
1-Aminopyrene neutralizes acids in exothermic reactions to form salts plus water. May be incompatible with isocyanates, halogenated organics, peroxides, phenols (acidic), epoxides, anhydrides, and acid halides. May generate hydrogen, a flammable gas, in combination with strong reducing agents such as hydrides. |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Flash Point: | 246.2°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
