Identification |
Name: | 2-Propen-1-one,3-(4-fluorophenyl)-1-phenyl- |
Synonyms: | Chalcone,4-fluoro- (6CI,7CI,8CI);3-(4-Fluorophenyl)-1-phenyl-2-propen-1-one;4-Fluorochalcone;NSC 88515;Phenyl p-fluorostyryl ketone;p-Fluorostyrylphenyl ketone;3-(4-Fluorophenyl)-1-phenylprop-2-en-1-one; |
CAS: | 1608-51-1 |
Molecular Formula: | C15H11FO |
Molecular Weight: | 226.25 |
InChI: | InChI=1/C15H11FO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11H/b11-8+ |
Molecular Structure: |
 |
Properties |
Melting Point: | 84-88 °C
|
Flash Point: | 157.3°C |
Boiling Point: | 345.9°Cat760mmHg |
Density: | 1.166g/cm3 |
Refractive index: | 1.608 |
Appearance: | Yellow crystalline powder |
Specification: | yellow crystalline powder Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face
protection 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
Flash Point: | 157.3°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |