| Identification | |
| Name: | 2-Propen-1-one,3-(4-fluorophenyl)-1-phenyl- |
| Synonyms: | Chalcone,4-fluoro- (6CI,7CI,8CI);3-(4-Fluorophenyl)-1-phenyl-2-propen-1-one;4-Fluorochalcone;NSC 88515;Phenyl p-fluorostyryl ketone;p-Fluorostyrylphenyl ketone;3-(4-Fluorophenyl)-1-phenylprop-2-en-1-one; |
| CAS: | 1608-51-1 |
| Molecular Formula: | C15H11FO |
| Molecular Weight: | 226.25 |
| InChI: | InChI=1/C15H11FO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11H/b11-8+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 84-88 °C |
| Flash Point: | 157.3°C |
| Boiling Point: | 345.9°Cat760mmHg |
| Density: | 1.166g/cm3 |
| Refractive index: | 1.608 |
| Appearance: | Yellow crystalline powder |
| Specification: | yellow crystalline powder Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 157.3°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
