| Identification |
| Name: | 2H-Indol-2-one,3-[1,3-dihydro-3-(hydroxyimino)-2H-indol-2-ylidene]-1,3-dihydro- |
| Synonyms: | Indirubin3'-monoxime; |
| CAS: | 160807-49-8 |
| Molecular Formula: | C16H11N3O2 |
| Molecular Weight: | 277.28 |
| InChI: | InChI=1/C16H11N3O2/c20-16-13(9-5-1-3-7-11(9)18-16)15-14(19-21)10-6-2-4-8-12(10)17-15/h1-8,17,21H,(H,18,20)/b15-13-,19-14+ |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Water Solubility: | DMSO: >10 mg/mL |
| Solubility: | DMSO: >10 mg/mL |
| Appearance: | Dark Red Solid |
| Biological Activity: | Protein kinase inhibitor: inhibits cyclin-dependent kinases (IC 50 = 0.18-3.33 μ M) and GSK-3 β (IC 50 = 0.19 μ M). Inhibits CDK5- and GSK-3 β -mediated tau phosphorylation, a process over-active in Alzheimer disease states. Also inhibits AMPK, LCK and SGK. Induces cell cycle arrest and inhibits cell proliferation. |
| Flash Point: | °C |
| Usage: | A potent inhibitor of GSK-3?(IC50=22nM). Also inhibits CDK1 (IC50=180nM) and CDK (IC50=100nM). It reversibly arrests asynchronous HBL-100 cells at G2. It induces apoptosis in the mammary carcinoma cell line MCF-7 (10). |
| Safety Data |
| |
 |
