| Identification | |
| Name: | 1,4-Benzodioxin-5-amine,2,3-dihydro- |
| Synonyms: | 1,4-Benzodioxan-5-amine(8CI);2,3-Dihydro-1,4-benzodioxin-5-amine;2,3-Ethylenedioxyaniline;5-Amino-1,4-benzodioxan;5-Amino-1,4-benzodioxane;5-Amino-2,3-dihydro-1,4-benzodioxin; |
| CAS: | 16081-45-1 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c9-6-2-1-3-7-8(6)11-5-4-10-7/h1-3H,4-5,9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131.1°C |
| Boiling Point: | 276.3°Cat760mmHg |
| Density: | 1.253g/cm3 |
| Refractive index: | 1.6 |
| Specification: |
1,4-Benzodioxin-5-amine,2,3-dihydro- , its cas register number is 16081-45-1. It also can be called 2,3-Dihydro-1,4-benzodioxin-5-amine ; 5-Amino-2,3-dihydro-1,4-benzodioxine and so on. |
| Flash Point: | 131.1°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
