| Identification |
| Name: | 4-Methylindole |
| Synonyms: | 4-Metlylindole;4-methyl-1H-indole; |
| CAS: | 16096-32-5 |
| EINECS: | 240-262-5 |
| Molecular Formula: | C9H9N |
| Molecular Weight: | 131.18 |
| InChI: | InChI=1/C9H9N/c1-7-3-2-4-9-8(7)5-6-10-9/h2-6,10H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.062 |
| Stability: | Stable under normal shipping and handling conditions. Substance undergoes color change upon exposure to light and air. |
| Refractive index: | 1.606-1.608 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | yellow - brown Clear liquid |
| Storage Temperature: | -20°C |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
