| Identification | |
| Name: | 1,3,5-Triazine-2,4-diamine,6-methoxy-N2,N4-bis(1-methylethyl)- |
| Synonyms: | 1,3,5-Triazine-2,4-diamine,6-methoxy-N,N'-bis(1-methylethyl)- (9CI); s-Triazine, 2,4-bis(isopropylamino)-6-methoxy-(6CI,8CI); 2,4-Bis(isopropylamino)-6-methoxy-s-triazine;2-Methoxy-4,6-bis(isopropylamino)-1,3,5-triazine;2-Methoxy-4,6-bis(isopropylamino)-s-triazine;4,6-Bis(isopropylamino)-2-methoxy-s-triazine; G 31435; Gesafram;Methoxypropazine; NSC 163048; Pramitol; Pramitol 5P; Prometon; Prometone |
| CAS: | 1610-18-0 |
| EINECS: | 216-548-0 |
| Molecular Formula: | C10H19 N5 O |
| Molecular Weight: | 225.34 |
| InChI: | InChI=1/C10H19N5O/c1-6(2)11-8-13-9(12-7(3)4)15-10(14-8)16-5/h6-7H,1-5H3,(H2,11,12,13,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 170.9°C |
| Boiling Point: | 359°Cat760mmHg |
| Density: | 1.133g/cm3 |
| Refractive index: | 1.566 |
| Solubility: | READILY SOL IN CHLOROFORM 150 g/L octan-1-ol In benzene >250, methanol, acetone >500, dichloromethane 350, toluene 250 (all in g/L, 20 deg C). Organic solvents g/100 mL at 20 deg C: n-hexane 1.2, methanol 60, cycylohexane 4.9, n-octanol 26 Very soluble in organic solvents In water, 750 mg/L at 20 deg C |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 170.9°C |
| Storage Temperature: | 0-6°C |
| Color: | Colorless powder White, crystalline Crystalline solid |
| Safety Data | |
 |
|
