| Identification | |
| Name: | 3-Buten-2-one,4-(4-fluorophenyl)- |
| Synonyms: | 3-Buten-2-one,4-(p-fluorophenyl)- (7CI,8CI); (4-Fluorobenzylidene)acetone;p-Fluorobenzalacetone |
| CAS: | 1611-38-7 |
| Molecular Formula: | C10H9 F O |
| Molecular Weight: | 164.18 |
| InChI: | InChI=1/C10H9FO/c1-8(12)2-3-9-4-6-10(11)7-5-9/h2-7H,1H3/b3-2+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 104.4°C |
| Boiling Point: | 259.9°Cat760mmHg |
| Density: | 1.107g/cm3 |
| Refractive index: | 1.544 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 104.4°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
