| Identification |
| Name: | 2,5-Dichloropyridine |
| Synonyms: | 2,5-Dichloro Pyridine;Pyridine, 2,5-dichloro-;LDP48:2,5-Dichloro Pyridine;2,5-Dichloropyridine 16110-09-1; |
| CAS: | 16110-09-1 |
| EINECS: | 240-278-2 |
| Molecular Formula: | C5H3Cl2N |
| Molecular Weight: | 147.99 |
| InChI: | InChI=1/C5H3Cl2N/c6-4-1-2-5(7)8-3-4/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.388 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.553 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | White to light yellow |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
