| Identification | |
| Name: | Benz[a]anthracene-7-methanol |
| Synonyms: | 7-(Hydroxymethyl)benz[a]anthracene |
| CAS: | 16110-13-7 |
| Molecular Formula: | C19H14 O |
| Molecular Weight: | 258.33 |
| InChI: | InChI=1/C19H14O/c20-12-19-16-8-4-2-6-14(16)11-18-15-7-3-1-5-13(15)9-10-17(18)19/h1-11,20H,12H2 |
| Molecular Structure: | ![(C19H14O) 7-(Hydroxymethyl)benz[a]anthracene](https://img1.guidechem.com/chem/e/dict/43/16110-13-7.jpg) |
| Properties | |
| Flash Point: | 227.5°C |
| Boiling Point: | 514.1°Cat760mmHg |
| Density: | 1.256g/cm3 |
| Refractive index: | 1.779 |
| Specification: |
Benz(a)anthracene-7-methanol ,its CAS number is 16110-13-7,it can be called 7-hydroxymethylbenz(a)anthracene and Tetraphen-7-ylmethanol . It is a toxic substance,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 227.5°C |
| Safety Data | |
 |
|
