| Identification | |
| Name: | Cyclopentanol,2-(4-morpholinyl)- |
| Synonyms: | 1-(Morpholin-4-yl)-2-hydroxycyclopentane;2-(Morpholin-4-yl)cyclopentanol; |
| CAS: | 161193-34-6 |
| Molecular Formula: | C9H17NO2 |
| Molecular Weight: | 171.24 |
| InChI: | InChI=1/C9H17NO2/c11-9-3-1-2-8(9)10-4-6-12-7-5-10/h8-9,11H,1-7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.157 g/cm3 |
| Refractive index: | 1.538 |
| Specification: |
The 1-(Morpholin-4-yl)-2-hydroxycyclopentane with the CAS number 161193-34-6 is also called Cyclopentanol,2-(4-morpholinyl)-. The systematic name is 2-morpholinocyclopentanol. Its molecular formula is C9H17NO2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 1-(Morpholin-4-yl)-2-hydroxycyclopentane are: (1)# of Rule of 5 Violations: 0 ; (2)#H bond acceptors: 3; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 2; (5)Polar Surface Area: 32.7Å2; (6)Index of Refraction: 1.538; (7)Molar Refractivity: 46.31 cm3; (8)Molar Volume: 147.9 cm3; (9)Polarizability: 18.35×10-24cm3; (10)Surface Tension: 48.8 dyne/cm; (11)Enthalpy of Vaporization: 59.46 kJ/mol; (12)Vapour Pressure: 0.000715 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
