| Identification | |
| Name: | 1-Methylindole-2-carboxylic acid |
| Synonyms: | Indole-2-carboxylicacid, 1-methyl- (6CI,7CI,8CI);1-Methyl-1H-indole-2-carboxylic acid;N-Methyl-2-indolecarboxylic acid; |
| CAS: | 16136-58-6 |
| EINECS: | 218-202-4 |
| Molecular Formula: | C10H9NO2 |
| Molecular Weight: | 175.18 |
| InChI: | InChI=1/C10H9NO2/c1-11-8-5-3-2-4-7(8)6-9(11)10(12)13/h2-6H,1H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.38 g/cm3 |
| Refractive index: | 1.612 |
| Appearance: | Beige crystalline powder |
| Specification: |
1-Methylindole-2-carboxylic acid , with CAS number of 4175-77-3, can be called 1-Methyl-1H-indole-2-carboxylic acid ; Indole-2-carboxylicacid, 1-methyl- (6CI,7CI,8CI) . It is a beige crystalline powder. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
