Identification |
Name: | Ribofuranose, 3-thio-,1-acetate 2,3,5-tribenzoate, b-D- (8CI) |
Synonyms: | Benzoicacid, thio-, S-ester with 3-thio-b-D-ribofuranose 1-acetate 2,5-dibenzoate; NSC 104537 |
CAS: | 16136-67-7 |
Molecular Formula: | C28H24 O8 S |
Molecular Weight: | 520.5504 |
InChI: | InChI=1/C28H24O8S/c1-18(29)34-28-23(36-26(31)20-13-7-3-8-14-20)24(37-27(32)21-15-9-4-10-16-21)22(35-28)17-33-25(30)19-11-5-2-6-12-19/h2-16,22-24,28H,17H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 320.1°C |
Boiling Point: | 637.8°Cat760mmHg |
Density: | 1.36g/cm3 |
Refractive index: | 1.63 |
Flash Point: | 320.1°C |
Safety Data |
|
 |