| Identification | |
| Name: | 3-[(2R)-2-Pyrrolidinylmethoxy]pyridine |
| Synonyms: | pyridine, 3-[(2R)-2-pyrrolidinylmethoxy]-;(R)-3-(pyrrolidin-2-ylmethoxy)pyridine;3-((R)-1-Pyrrolidin-2-ylmethoxy)-pyridine; |
| CAS: | 161416-94-0 |
| Molecular Formula: | C10H14N2O |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C10H14N2O/c1-3-9(12-6-1)8-13-10-4-2-5-11-7-10/h2,4-5,7,9,12H,1,3,6,8H2/t9-/m1/s1 |
| Molecular Structure: | ![(C10H14N2O) pyridine, 3-[(2R)-2-pyrrolidinylmethoxy]-;(R)-3-(pyrrolidin-2-ylmethoxy)pyridine;3-((R)-1-Pyrrolidin...](https://img.guidechem.com/structureimg/161416-94-0.gif) |
| Properties | |
| Density: | 1.064 |
| Refractive index: | 1.519 |
| Specification: |
The 3-[(2R)-2-Pyrrolidinylmethoxy]pyridine with the cas number 161416-94-0, is also called pyridine, 3-[(2R)-2-pyrrolidinylmethoxy]- .The properties of the 3-[(2R)-2-Pyrrolidinylmethoxy]pyridine are: (1)#H bond acceptors: 3 ; (2)#H bond donors: 1 ; (3)#Freely Rotating Bonds: 3 ; (4)Polar Surface Area: 34.15 Å2 ; (5)Index of Refraction: 1.519 ; (6)Molar Refractivity: 50.83 cm3 ; (7)Molar Volume: 167.431 cm3 ; (8)Polarizability: 20.15×10-24cm3 ; (9)Surface Tension: 40.922 dyne/cm ; (10)Enthalpy of Vaporization: 54.086 kJ/mol ; (11)Vapour Pressure: 0.001 mmHg at 25°C. You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
