| Identification | |
| Name: | Ethanol, 2-methoxy-,1-carbamate |
| Synonyms: | Carbamicacid, 2-methoxyethyl ester (6CI,7CI); Ethanol, 2-methoxy-, carbamate (8CI,9CI);2-Methoxyethyl carbamate; Methoxyethyl carbamate; NSC 158607 |
| CAS: | 1616-88-2 |
| EINECS: | 216-569-5 |
| Molecular Formula: | C4H9 N O3 |
| Molecular Weight: | 119.24 |
| InChI: | InChI=1/C4H9NO3/c1-7-2-3-8-4(5)6/h2-3H2,1H3,(H2,5,6) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131°C |
| Boiling Point: | 236.7°Cat760mmHg |
| Density: | 1.102g/cm3 |
| Refractive index: | 1.424 |
| Specification: |
Methoxyethyl carbamate , its cas register number is 1616-88-2. It also can be called 2-Methoxyethyl carbamate ; Carbamic acid, 2-methoxyethyl ester ; Ethanol, 2-methoxy-, carbamate ; and N-Methoxyurethane . Its classification code are Skin / Eye Irritant and Tumor data. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 131°C |
| Safety Data | |
 |
|
