| Identification | |
| Name: | Boronicacid, B-(2,6-difluorophenyl)- |
| Synonyms: | 2,6-Difluorophenyl boronic acid; |
| CAS: | 162101-25-9 |
| EINECS: | -0 |
| Molecular Formula: | C6H5BF2O2 |
| Molecular Weight: | 157.91 |
| InChI: | InChI=1/C8H9FO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 87.9°C |
| Boiling Point: | 193.1°C at 760 mmHg |
| Density: | 1.123g/cm3 |
| Refractive index: | 1.51 |
| Appearance: | White to off-white crystalline powder |
| Flash Point: | 87.9°C |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
