| Identification | |
| Name: | 1H-Benzimidazol-2-amine,1-methyl- |
| Synonyms: | Benzimidazole,2-amino-1-methyl- (6CI,7CI,8CI); 1-Methyl-1H-benzimidazole-2-amine;1-Methyl-1H-benzo[d]imidazol-2-amine; 1-Methyl-2-aminobenzimidazole;2-Amino-1-methyl-1H-benzimidazole; 2-Amino-1-methylbenzimidazole |
| CAS: | 1622-57-7 |
| EINECS: | 231-538-6 |
| Molecular Formula: | C8H9 N3 |
| Molecular Weight: | 147.18 |
| InChI: | InChI=1/C8H9N3/c1-11-7-5-3-2-4-6(7)10-8(11)9/h2-5H,1H3,(H2,9,10) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 203-206 °C |
| Flash Point: | 156.3°C |
| Boiling Point: | 334.9°Cat760mmHg |
| Density: | 1.27g/cm3 |
| Refractive index: | 1.667 |
| Appearance: | white to beige fine crystalline powder |
| Specification: | white to beige fine crystalline powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 156.3°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
