Identification |
Name: | 2(5H)-Furanone,3-(1,3-benzodioxol-5-yl)-5-hydroxy-5-(4-methoxyphenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]- |
Synonyms: | CI 1020 |
CAS: | 162256-50-0 |
Molecular Formula: | C28H26 O9 |
Molecular Weight: | 0 |
InChI: | InChI=1/C28H26O9/c1-31-19-8-6-18(7-9-19)28(30)20(11-16-12-23(32-2)26(34-4)24(13-16)33-3)25(27(29)37-28)17-5-10-21-22(14-17)36-15-35-21/h5-10,12-14,30H,11,15H2,1-4H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 242.505°C |
Boiling Point: | 722.338°C at 760 mmHg |
Density: | 1.351g/cm3 |
Refractive index: | 1.623 |
Biological Activity: | Highly selective, orally active, non-peptide endothelin-A receptor (ET A ) antagonist (IC 50 values are 0.3 and 480 nM for ET A and ET B receptors respectively). Antihypertensive; blocks ET-1-induced pressor responses following oral administration. |
Flash Point: | 242.505°C |
Usage: | A novel endothelin-A receptor antagonist, in hypoxic pulmonary hypertension. |
Safety Data |
|
 |