| Identification | |
| Name: | 4-octylaniline |
| Synonyms: | Octylaniline; 95%; 4-n-Octylaniline |
| CAS: | 16245-79-7 |
| EINECS: | 240-358-7 |
| Molecular Formula: | C14H23N |
| Molecular Weight: | 205.3392 |
| InChI: | InChI=1S/C14H23N/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13/h9-12H,2-8,15H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | 1.516 |
| Water Solubility: | Nonsoluble in water. Fully miscible with ethanol, acetone, toluene |
| Solubility: | Nonsoluble in water. Fully miscible with ethanol, acetone, toluene |
| Appearance: | Light yellow to tan-brown liquid, aromatic amine odor |
| Specification: |
4-Octylaniline (CAS NO.16245-79-7) is also named as Benzenamine, 4-octyl- ; p-Octylaniline; 4-n-Octylaniline ; 4-Octylphenylamine . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
