| Identification | |
| Name: | methyl [4-bromo-2-(chloromethyl)phenoxy]acetate - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1) |
| Synonyms: | Hexamethylenetetramine, compd. with methyl((4-bromo-alpha-chloro-o-tolyl)oxy)acetate (1:1);((4-Bromo-alpha-chloro-o-tolyl)oxy)acetic acid methyl ester, compd. with hexamethylenetetramine (1:1);Acetic acid, ((4-bromo-2-(chloromethyl))phenoxy)-, methyl ester, compd. with 1,3,5,7-tetraazatricyclo(3.3.1.1(sup 3,7))decane (1:1);methyl[4-bromo-2-(chloromethyl)phenoxy]acetate- 1,3,5,7-tetraazatricyclo[3.3.1.13,7]decane(1:1);AC1L4MHB;AC1Q3U7H;AR-1J6578;AR-1J6579;LS-11136 |
| CAS: | 16253-49-9 |
| Molecular Formula: | C16H22BrClN4O3 |
| Molecular Weight: | 433.7279 |
| InChI: | InChI=1/C10H10BrClO3.C6H12N4/c1-14-10(13)6-15-9-3-2-8(11)4-7(9)5-12;1-7-2-9-4-8(1)5-10(3-7)6-9/h2-4H,5-6H2,1H3;1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 165.3°C |
| Boiling Point: | 349.8°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 165.3°C |
| Safety Data | |
 |
|
