| Identification | |
| Name: | 1H-Inden-1-one,4,6-difluoro-2,3-dihydro- |
| Synonyms: | 4,6-Difluoro-2,3-dihydroinden-1-one; |
| CAS: | 162548-73-4 |
| Molecular Formula: | C9H6F2O |
| Molecular Weight: | 168.14 |
| InChI: | InChI=1/C9H6F2O/c10-5-3-7-6(8(11)4-5)1-2-9(7)12/h3-4H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 89.925°C |
| Boiling Point: | 237.291°C at 760 mmHg |
| Density: | 1.362g/cm3 |
| Refractive index: | 1.537 |
| Specification: |
1H-Inden-1-one,4,6-difluoro-2,3-dihydro- , with CAS number of 162548-73-4, can be called 1H-inden-1-one, 4,6-difluoro-2,3-dihydro- ; 4,6-Difluor-2,3-dihydro-1H-inden-1-on ; 4,6-Difluorindan-1-on ; 4,6-Difluoroindan-1-one ; 162548-73-4 [RN] ; 4,6-Difluoro-1-indanone ; 4,6-Difluoro-2,3-dihydro-1H-inden-1-one ; 4,6-difluoro-2,3-dihydroinden-1-one . |
| Flash Point: | 89.925°C |
| Safety Data | |
 |
|
